C7H11N5 — CID 168918327
N',6-diamino-2-methylpyridine-3-carboximidamide (PubChem CID 168918327) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is N',6-diamino-2-methylpyridine-3-carboximidamide.
| Compound Name | N',6-diamino-2-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 168918327 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N',6-diamino-2-methylpyridine-3-carboximidamide |
| SMILES | Cc1nc(N)ccc1/C(N)=N/N |
| InChI | InChI=1S/C7H11N5/c1-4-5(7(9)12-10)2-3-6(8)11-4/h2-3H,10H2,1H3,(H2,8,11)(H2,9,12) |
| InChIKey | HELYPJXDGLFQFN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|