C6H10N6 — CID 171396587
N',2-diamino-4-methylpyrimidine-5-carboximidamide (PubChem CID 171396587) has the molecular formula C6H10N6 and a molecular weight of 166.19 g/mol. Its IUPAC name is N',2-diamino-4-methylpyrimidine-5-carboximidamide.
| Compound Name | N',2-diamino-4-methylpyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 171396587 |
| Molecular Formula | C6H10N6 |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | N',2-diamino-4-methylpyrimidine-5-carboximidamide |
| SMILES | Cc1nc(N)ncc1/C(N)=N/N |
| InChI | InChI=1S/C6H10N6/c1-3-4(5(7)12-9)2-10-6(8)11-3/h2H,9H2,1H3,(H2,7,12)(H2,8,10,11) |
| InChIKey | DSLZYILICBVFCC-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|