C7H10N4O — CID 159487487
1-[2-amino-4-(methylamino)pyrimidin-5-yl]ethanone (PubChem CID 159487487) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-[2-amino-4-(methylamino)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[2-amino-4-(methylamino)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 159487487 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-[2-amino-4-(methylamino)pyrimidin-5-yl]ethanone |
| SMILES | CNc1nc(N)ncc1C(C)=O |
| InChI | InChI=1S/C7H10N4O/c1-4(12)5-3-10-7(8)11-6(5)9-2/h3H,1-2H3,(H3,8,9,10,11) |
| InChIKey | HOKJEWKRWXBFMN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |