C7H11N5 — CID 154937324
5-(2-aminoethenyl)-4-N-methylpyrimidine-2,4-diamine (PubChem CID 154937324) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-(2-aminoethenyl)-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-(2-aminoethenyl)-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154937324 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 5-(2-aminoethenyl)-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(N)ncc1C=CN |
| InChI | InChI=1S/C7H11N5/c1-10-6-5(2-3-8)4-11-7(9)12-6/h2-4H,8H2,1H3,(H3,9,10,11,12) |
| InChIKey | SOFQFTJACSCQEF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |