C9H10N4O — CID 91079604
5-(2-methoxyethenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 91079604) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 5-(2-methoxyethenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-(2-methoxyethenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91079604 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-(2-methoxyethenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COC=Cc1c[nH]c2nc(N)ncc12 |
| InChI | InChI=1S/C9H10N4O/c1-14-3-2-6-4-11-8-7(6)5-12-9(10)13-8/h2-5H,1H3,(H3,10,11,12,13) |
| InChIKey | PGJSLPUOCSWOCH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|