C9H12N4O — CID 82656453
N-methoxy-1-(2-methyl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methanamine (PubChem CID 82656453) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-methoxy-1-(2-methyl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methanamine.
| Compound Name | N-methoxy-1-(2-methyl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methanamine |
|---|---|
| PubChem CID | 82656453 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-methoxy-1-(2-methyl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methanamine |
| SMILES | CONCc1c[nH]c2nc(C)ncc12 |
| InChI | InChI=1S/C9H12N4O/c1-6-10-5-8-7(4-12-14-2)3-11-9(8)13-6/h3,5,12H,4H2,1-2H3,(H,10,11,13) |
| InChIKey | GFZYVHRRTWMABC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|