C6H10N4OS — CID 174421328
6-amino-5-[(methoxyamino)methyl]-1H-pyrimidine-2-thione (PubChem CID 174421328) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 6-amino-5-[(methoxyamino)methyl]-1H-pyrimidine-2-thione.
| Compound Name | 6-amino-5-[(methoxyamino)methyl]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 174421328 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 6-amino-5-[(methoxyamino)methyl]-1H-pyrimidine-2-thione |
| SMILES | CONCc1cnc(=S)[nH]c1N |
| InChI | InChI=1S/C6H10N4OS/c1-11-9-3-4-2-8-6(12)10-5(4)7/h2,9H,3H2,1H3,(H3,7,8,10,12) |
| InChIKey | REJLICKTWKCQSH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|