C12H13ClN2O — CID 165344517
4-chloro-2-(2-methoxyethenyl)-6,7-dimethyl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 165344517) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 4-chloro-2-(2-methoxyethenyl)-6,7-dimethyl-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 4-chloro-2-(2-methoxyethenyl)-6,7-dimethyl-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 165344517 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-chloro-2-(2-methoxyethenyl)-6,7-dimethyl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | COC=Cc1cc2c(Cl)nc(C)c(C)c2[nH]1 |
| InChI | InChI=1S/C12H13ClN2O/c1-7-8(2)14-12(13)10-6-9(4-5-16-3)15-11(7)10/h4-6,15H,1-3H3 |
| InChIKey | YZUUCGLTEZHCBV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|