C15H13ClN4O2 — CID 155776545
6-chloro-8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-7H-purine (PubChem CID 155776545) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is 6-chloro-8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-7H-purine.
| Compound Name | 6-chloro-8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-7H-purine |
|---|---|
| PubChem CID | 155776545 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 6-chloro-8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-7H-purine |
| SMILES | COc1ccc(/C=C/c2nc3ncnc(Cl)c3[nH]2)cc1OC |
| InChI | InChI=1S/C15H13ClN4O2/c1-21-10-5-3-9(7-11(10)22-2)4-6-12-19-13-14(16)17-8-18-15(13)20-12/h3-8H,1-2H3,(H,17,18,19,20)/b6-4+ |
| InChIKey | VJGYJPBVLPLQMY-GQCTYLIASA-N |
| XLogP | 3.19 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |