C23H23N5O3 — CID 175103865
8-[2-(3,4-dimethoxyphenyl)ethenyl]-N-(4-ethoxyphenyl)-7H-purin-6-amine (PubChem CID 175103865) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 8-[2-(3,4-dimethoxyphenyl)ethenyl]-N-(4-ethoxyphenyl)-7H-purin-6-amine.
| Compound Name | 8-[2-(3,4-dimethoxyphenyl)ethenyl]-N-(4-ethoxyphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 175103865 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 8-[2-(3,4-dimethoxyphenyl)ethenyl]-N-(4-ethoxyphenyl)-7H-purin-6-amine |
| SMILES | CCOc1ccc(Nc2ncnc3nc(C=Cc4ccc(OC)c(OC)c4)[nH]c23)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-4-31-17-9-7-16(8-10-17)26-22-21-23(25-14-24-22)28-20(27-21)12-6-15-5-11-18(29-2)19(13-15)30-3/h5-14H,4H2,1-3H3,(H2,24,25,26,27,28) |
| InChIKey | HUVCXTRIDGWPRV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |