C19H18N2O4 — CID 18431184
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5,6-dimethyl-1H-benzimidazole-4,7-dione (PubChem CID 18431184) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5,6-dimethyl-1H-benzimidazole-4,7-dione.
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5,6-dimethyl-1H-benzimidazole-4,7-dione |
|---|---|
| PubChem CID | 18431184 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5,6-dimethyl-1H-benzimidazole-4,7-dione |
| SMILES | COc1ccc(/C=C/c2nc3c([nH]2)C(=O)C(C)=C(C)C3=O)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-10-11(2)19(23)17-16(18(10)22)20-15(21-17)8-6-12-5-7-13(24-3)14(9-12)25-4/h5-9H,1-4H3,(H,20,21)/b8-6+ |
| InChIKey | FMNIIPCIVIAMRR-SOFGYWHQSA-N |
| XLogP | 3.31 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|