C13H18BrNO — CID 171557672
1-(6-bromo-2-methyl-3-pyridinyl)-2,2-dimethylpentan-1-one (PubChem CID 171557672) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 1-(6-bromo-2-methyl-3-pyridinyl)-2,2-dimethylpentan-1-one.
| Compound Name | 1-(6-bromo-2-methyl-3-pyridinyl)-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 171557672 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-(6-bromo-2-methyl-3-pyridinyl)-2,2-dimethylpentan-1-one |
| SMILES | CCCC(C)(C)C(=O)c1ccc(Br)nc1C |
| InChI | InChI=1S/C13H18BrNO/c1-5-8-13(3,4)12(16)10-6-7-11(14)15-9(10)2/h6-7H,5,8H2,1-4H3 |
| InChIKey | YVKUOQLQVZTJLX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|