C13H22N2O — CID 134301353
1-(1,3-dimethylpyrazol-4-yl)-2,2-dimethylhexan-1-one (PubChem CID 134301353) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-2,2-dimethylhexan-1-one.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-2,2-dimethylhexan-1-one |
|---|---|
| PubChem CID | 134301353 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-2,2-dimethylhexan-1-one |
| SMILES | CCCCC(C)(C)C(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C13H22N2O/c1-6-7-8-13(3,4)12(16)11-9-15(5)14-10(11)2/h9H,6-8H2,1-5H3 |
| InChIKey | QHDYVANLNSHSJC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |