C24H33FO5 — CID 168939603
[4-ethoxy-3-fluoro-2-(4-methylpent-3-enyl)-8-oxo-7-pentyl-2,5-dihydrochromen-5-yl] acetate (PubChem CID 168939603) has the molecular formula C24H33FO5 and a molecular weight of 420.52 g/mol. Its IUPAC name is [4-ethoxy-3-fluoro-2-(4-methylpent-3-enyl)-8-oxo-7-pentyl-2,5-dihydrochromen-5-yl] acetate.
| Compound Name | [4-ethoxy-3-fluoro-2-(4-methylpent-3-enyl)-8-oxo-7-pentyl-2,5-dihydrochromen-5-yl] acetate |
|---|---|
| PubChem CID | 168939603 |
| Molecular Formula | C24H33FO5 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [4-ethoxy-3-fluoro-2-(4-methylpent-3-enyl)-8-oxo-7-pentyl-2,5-dihydrochromen-5-yl] acetate |
| SMILES | CCCCCC1=CC(OC(C)=O)C2=C(OC(CCC=C(C)C)C(F)=C2OCC)C1=O |
| InChI | InChI=1S/C24H33FO5/c1-6-8-9-12-17-14-19(29-16(5)26)20-23(28-7-2)21(25)18(13-10-11-15(3)4)30-24(20)22(17)27/h11,14,18-19H,6-10,12-13H2,1-5H3 |
| InChIKey | NJUHLSRTLRDLMQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|