C26H34N4O2S — CID 168939846
N-but-3-yn-2-yl-2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetamide (PubChem CID 168939846) has the molecular formula C26H34N4O2S and a molecular weight of 466.65 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetamide.
| Compound Name | N-but-3-yn-2-yl-2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 168939846 |
| Molecular Formula | C26H34N4O2S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-but-3-yn-2-yl-2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetamide |
| SMILES | C#CC(C)NC(=O)CNC(=O)CN(SC)C1CCN(C(C)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C26H34N4O2S/c1-5-19(2)28-25(31)17-27-26(32)18-30(33-4)22-13-15-29(16-14-22)20(3)23-12-8-10-21-9-6-7-11-24(21)23/h1,6-12,19-20,22H,13-18H2,2-4H3,(H,27,32)(H,28,31) |
| InChIKey | NICXKPKXXYBGKX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|