C27H34N4O2S — CID 168940000
2-[[2-[cyclopropylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]-N-prop-2-ynylacetamide (PubChem CID 168940000) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 2-[[2-[cyclopropylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[2-[cyclopropylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 168940000 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2-[[2-[cyclopropylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CNC(=O)CN(SC1CC1)C1CCN(C(C)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C27H34N4O2S/c1-3-15-28-26(32)18-29-27(33)19-31(34-23-11-12-23)22-13-16-30(17-14-22)20(2)24-10-6-8-21-7-4-5-9-25(21)24/h1,4-10,20,22-23H,11-19H2,2H3,(H,28,32)(H,29,33) |
| InChIKey | RAJBTGYXDQBCHK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|