C28H35N5O4S — CID 168939965
methyl (E)-2-cyano-4-[[2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetyl]amino]but-2-enoate (PubChem CID 168939965) has the molecular formula C28H35N5O4S and a molecular weight of 537.69 g/mol. Its IUPAC name is methyl (E)-2-cyano-4-[[2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetyl]amino]but-2-enoate.
| Compound Name | methyl (E)-2-cyano-4-[[2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 168939965 |
| Molecular Formula | C28H35N5O4S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | methyl (E)-2-cyano-4-[[2-[[2-[methylsulfanyl-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]amino]acetyl]amino]acetyl]amino]but-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/CNC(=O)CNC(=O)CN(SC)C1CCN(C(C)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C28H35N5O4S/c1-20(24-10-6-8-21-7-4-5-9-25(21)24)32-15-12-23(13-16-32)33(38-3)19-27(35)31-18-26(34)30-14-11-22(17-29)28(36)37-2/h4-11,20,23H,12-16,18-19H2,1-3H3,(H,30,34)(H,31,35)/b22-11+ |
| InChIKey | JZQBDKUPWZGSAN-SSDVNMTOSA-N |
| XLogP | 2.80 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|