C20H34N2O4 — CID 168941862
(Z)-N-[1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethyl-1-oxobutan-2-yl]hex-4-enamide;formic acid (PubChem CID 168941862) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is (Z)-N-[1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethyl-1-oxobutan-2-yl]hex-4-enamide;formic acid.
| Compound Name | (Z)-N-[1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethyl-1-oxobutan-2-yl]hex-4-enamide;formic acid |
|---|---|
| PubChem CID | 168941862 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (Z)-N-[1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethyl-1-oxobutan-2-yl]hex-4-enamide;formic acid |
| SMILES | C/C=C\CCC(=O)NC(C(=O)N1CC2C(C1)C2(C)C)C(C)(C)C.O=CO |
| InChI | InChI=1S/C19H32N2O2.CH2O2/c1-7-8-9-10-15(22)20-16(18(2,3)4)17(23)21-11-13-14(12-21)19(13,5)6;2-1-3/h7-8,13-14,16H,9-12H2,1-6H3,(H,20,22);1H,(H,2,3)/b8-7-; |
| InChIKey | YDJNZIIJCSDOIB-CFYXSCKTSA-N |
| XLogP | 2.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|