C23H42N2O7 — CID 176699952
N-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 176699952) has the molecular formula C23H42N2O7 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 176699952 |
| Molecular Formula | C23H42N2O7 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | N-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | CC1CCCN1C(=O)C(NC(=O)CCOCCOCCOCCOCCC=O)C(C)(C)C |
| InChI | InChI=1S/C23H42N2O7/c1-19-7-5-9-25(19)22(28)21(23(2,3)4)24-20(27)8-12-30-14-16-32-18-17-31-15-13-29-11-6-10-26/h10,19,21H,5-9,11-18H2,1-4H3,(H,24,27) |
| InChIKey | DDWKEXGGBYDRPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|