C26H45N3O3 — CID 167519604
N-[4-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-4-oxobutyl]-N-methyldec-9-ynamide (PubChem CID 167519604) has the molecular formula C26H45N3O3 and a molecular weight of 447.66 g/mol. Its IUPAC name is N-[4-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-4-oxobutyl]-N-methyldec-9-ynamide.
| Compound Name | N-[4-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-4-oxobutyl]-N-methyldec-9-ynamide |
|---|---|
| PubChem CID | 167519604 |
| Molecular Formula | C26H45N3O3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | N-[4-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-4-oxobutyl]-N-methyldec-9-ynamide |
| SMILES | C#CCCCCCCCC(=O)N(C)CCCC(=O)NC(C(=O)N1CCCC1C)C(C)(C)C |
| InChI | InChI=1S/C26H45N3O3/c1-7-8-9-10-11-12-13-18-23(31)28(6)19-15-17-22(30)27-24(26(3,4)5)25(32)29-20-14-16-21(29)2/h1,21,24H,8-20H2,2-6H3,(H,27,30) |
| InChIKey | SANVWSBSTSPTSR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|