C20H36N2O4 — CID 170412054
methyl 8-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-8-oxooctanoate (PubChem CID 170412054) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is methyl 8-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-8-oxooctanoate.
| Compound Name | methyl 8-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 170412054 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | methyl 8-[[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]amino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)NC(C(=O)N1CCCC1C)C(C)(C)C |
| InChI | InChI=1S/C20H36N2O4/c1-15-11-10-14-22(15)19(25)18(20(2,3)4)21-16(23)12-8-6-7-9-13-17(24)26-5/h15,18H,6-14H2,1-5H3,(H,21,23) |
| InChIKey | QWZYQPAVYDZBRF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|