C28H36N2O4 — CID 146398361
N-[(2S)-3,3-dimethyl-1-[(2R)-2-methylpyrrolidin-1-yl]-1-oxobutan-2-yl]-4-[4-(4-formylphenyl)phenoxy]butanamide (PubChem CID 146398361) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-[(2R)-2-methylpyrrolidin-1-yl]-1-oxobutan-2-yl]-4-[4-(4-formylphenyl)phenoxy]butanamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-[(2R)-2-methylpyrrolidin-1-yl]-1-oxobutan-2-yl]-4-[4-(4-formylphenyl)phenoxy]butanamide |
|---|---|
| PubChem CID | 146398361 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-[(2R)-2-methylpyrrolidin-1-yl]-1-oxobutan-2-yl]-4-[4-(4-formylphenyl)phenoxy]butanamide |
| SMILES | C[C@@H]1CCCN1C(=O)[C@@H](NC(=O)CCCOc1ccc(-c2ccc(C=O)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H36N2O4/c1-20-7-5-17-30(20)27(33)26(28(2,3)4)29-25(32)8-6-18-34-24-15-13-23(14-16-24)22-11-9-21(19-31)10-12-22/h9-16,19-20,26H,5-8,17-18H2,1-4H3,(H,29,32)/t20-,26-/m1/s1 |
| InChIKey | ACLCFDJZIZQXDD-FQRUVTKNSA-N |
| XLogP | 4.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|