C22H25B2N3O2 — CID 168945053
CID 168945053 (PubChem CID 168945053) has the molecular formula C22H25B2N3O2 and a molecular weight of 385.09 g/mol.
| Compound Name | CID 168945053 |
|---|---|
| PubChem CID | 168945053 |
| Molecular Formula | C22H25B2N3O2 |
| Molecular Weight | 385.09 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c3c(c([B])n(C(C)=O)c3c1)CC1C2=CC(C(=O)N(CC)CC)CN1C |
| InChI | InChI=1S/C22H25B2N3O2/c1-5-26(6-2)22(29)13-7-15-16-8-14(23)9-19-20(16)17(10-18(15)25(4)11-13)21(24)27(19)12(3)28/h7-9,13,18H,5-6,10-11H2,1-4H3 |
| InChIKey | XUTBARQMDDVMDA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.09 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|