C22H24B3N3O2 — CID 168945029
CID 168945029 (PubChem CID 168945029) has the molecular formula C22H24B3N3O2 and a molecular weight of 394.89 g/mol.
| Compound Name | CID 168945029 |
|---|---|
| PubChem CID | 168945029 |
| Molecular Formula | C22H24B3N3O2 |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c3c(c([B])n(C(C)=O)c3c1[B])CC1C2=CC(C(=O)N(CC)CC)CN1C |
| InChI | InChI=1S/C22H24B3N3O2/c1-5-27(6-2)22(30)12-7-13-14-8-16(23)19(24)20-18(14)15(9-17(13)26(4)10-12)21(25)28(20)11(3)29/h7-8,12,17H,5-6,9-10H2,1-4H3 |
| InChIKey | RXTFVWKSGAHWSH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|