C22H21FN4O2S — CID 168945299
N-[4-(3-amino-1H-indazol-4-yl)-2-[(4-fluorophenyl)methoxy]phenyl]ethanesulfinamide (PubChem CID 168945299) has the molecular formula C22H21FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[4-(3-amino-1H-indazol-4-yl)-2-[(4-fluorophenyl)methoxy]phenyl]ethanesulfinamide.
| Compound Name | N-[4-(3-amino-1H-indazol-4-yl)-2-[(4-fluorophenyl)methoxy]phenyl]ethanesulfinamide |
|---|---|
| PubChem CID | 168945299 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-[4-(3-amino-1H-indazol-4-yl)-2-[(4-fluorophenyl)methoxy]phenyl]ethanesulfinamide |
| SMILES | CCS(=O)Nc1ccc(-c2cccc3[nH]nc(N)c23)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN4O2S/c1-2-30(28)27-18-11-8-15(17-4-3-5-19-21(17)22(24)26-25-19)12-20(18)29-13-14-6-9-16(23)10-7-14/h3-12,27H,2,13H2,1H3,(H3,24,25,26) |
| InChIKey | MYBKNPIQQAMXSQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |