C20H13FIN3O4 — CID 168945393
3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-7-iodofuro[3,2-c]pyridin-4-amine (PubChem CID 168945393) has the molecular formula C20H13FIN3O4 and a molecular weight of 505.24 g/mol. Its IUPAC name is 3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-7-iodofuro[3,2-c]pyridin-4-amine.
| Compound Name | 3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-7-iodofuro[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 168945393 |
| Molecular Formula | C20H13FIN3O4 |
| Molecular Weight | 505.24 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | 3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-7-iodofuro[3,2-c]pyridin-4-amine |
| SMILES | Nc1ncc(I)c2occ(-c3ccc([N+](=O)[O-])c(OCc4ccc(F)cc4)c3)c12 |
| InChI | InChI=1S/C20H13FIN3O4/c21-13-4-1-11(2-5-13)9-28-17-7-12(3-6-16(17)25(26)27)14-10-29-19-15(22)8-24-20(23)18(14)19/h1-8,10H,9H2,(H2,23,24) |
| InChIKey | KTSOFDKBTVWWKG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.24 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|