C16H12FN3O6 — CID 15552066
3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-5-methoxy-1,3,4-oxadiazol-2-one (PubChem CID 15552066) has the molecular formula C16H12FN3O6 and a molecular weight of 361.29 g/mol. Its IUPAC name is 3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-5-methoxy-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-5-methoxy-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 15552066 |
| Molecular Formula | C16H12FN3O6 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-[3-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-5-methoxy-1,3,4-oxadiazol-2-one |
| SMILES | COc1nn(-c2ccc([N+](=O)[O-])c(OCc3ccc(F)cc3)c2)c(=O)o1 |
| InChI | InChI=1S/C16H12FN3O6/c1-24-15-18-19(16(21)26-15)12-6-7-13(20(22)23)14(8-12)25-9-10-2-4-11(17)5-3-10/h2-8H,9H2,1H3 |
| InChIKey | KHICPASJCVEVBY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 109.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|