C15H11FN2O3 — CID 154151743
3-(3-fluorophenyl)-5-phenylmethoxy-1,3,4-oxadiazol-2-one (PubChem CID 154151743) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-phenylmethoxy-1,3,4-oxadiazol-2-one.
| Compound Name | 3-(3-fluorophenyl)-5-phenylmethoxy-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 154151743 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-(3-fluorophenyl)-5-phenylmethoxy-1,3,4-oxadiazol-2-one |
| SMILES | O=c1oc(OCc2ccccc2)nn1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H11FN2O3/c16-12-7-4-8-13(9-12)18-15(19)21-14(17-18)20-10-11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIKey | ZEYHTAKNAUOTCO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |