C13H12F2N2O2 — CID 168946978
2-(4,5-difluoro-1H-indol-3-yl)-N-ethyl-N-methyl-2-oxoacetamide (PubChem CID 168946978) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-(4,5-difluoro-1H-indol-3-yl)-N-ethyl-N-methyl-2-oxoacetamide.
| Compound Name | 2-(4,5-difluoro-1H-indol-3-yl)-N-ethyl-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 168946978 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-(4,5-difluoro-1H-indol-3-yl)-N-ethyl-N-methyl-2-oxoacetamide |
| SMILES | CCN(C)C(=O)C(=O)c1c[nH]c2ccc(F)c(F)c12 |
| InChI | InChI=1S/C13H12F2N2O2/c1-3-17(2)13(19)12(18)7-6-16-9-5-4-8(14)11(15)10(7)9/h4-6,16H,3H2,1-2H3 |
| InChIKey | CERSOHOPDFRMBW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|