C29H25BrF3N3O — CID 168948085
2-[4-bromo-1-(2,5-difluorophenyl)but-3-ynyl]-4-fluoro-6-[4-(4-methylpiperazin-1-yl)phenyl]-3H-isoindol-1-one (PubChem CID 168948085) has the molecular formula C29H25BrF3N3O and a molecular weight of 568.44 g/mol. Its IUPAC name is 2-[4-bromo-1-(2,5-difluorophenyl)but-3-ynyl]-4-fluoro-6-[4-(4-methylpiperazin-1-yl)phenyl]-3H-isoindol-1-one.
| Compound Name | 2-[4-bromo-1-(2,5-difluorophenyl)but-3-ynyl]-4-fluoro-6-[4-(4-methylpiperazin-1-yl)phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 168948085 |
| Molecular Formula | C29H25BrF3N3O |
| Molecular Weight | 568.44 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 2-[4-bromo-1-(2,5-difluorophenyl)but-3-ynyl]-4-fluoro-6-[4-(4-methylpiperazin-1-yl)phenyl]-3H-isoindol-1-one |
| SMILES | CN1CCN(c2ccc(-c3cc(F)c4c(c3)C(=O)N(C(CC#CBr)c3cc(F)ccc3F)C4)cc2)CC1 |
| InChI | InChI=1S/C29H25BrF3N3O/c1-34-11-13-35(14-12-34)22-7-4-19(5-8-22)20-15-23-25(27(33)16-20)18-36(29(23)37)28(3-2-10-30)24-17-21(31)6-9-26(24)32/h4-9,15-17,28H,3,11-14,18H2,1H3 |
| InChIKey | CQKVPZHLBIZBGJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|