C25H28ClN5O2S — CID 168948813
(7R,13S)-9-(2-chlorophenyl)-3,7,13-trimethyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene;morpholine-4-carbaldehyde (PubChem CID 168948813) has the molecular formula C25H28ClN5O2S and a molecular weight of 498.05 g/mol. Its IUPAC name is (7R,13S)-9-(2-chlorophenyl)-3,7,13-trimethyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene;morpholine-4-carbaldehyde.
| Compound Name | (7R,13S)-9-(2-chlorophenyl)-3,7,13-trimethyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene;morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 168948813 |
| Molecular Formula | C25H28ClN5O2S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (7R,13S)-9-(2-chlorophenyl)-3,7,13-trimethyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene;morpholine-4-carbaldehyde |
| SMILES | Cc1nnc2n1-c1sc3c(c1C(c1ccccc1Cl)=N[C@@H]2C)C[C@H](C)C3.O=CN1CCOCC1 |
| InChI | InChI=1S/C20H19ClN4S.C5H9NO2/c1-10-8-14-16(9-10)26-20-17(14)18(13-6-4-5-7-15(13)21)22-11(2)19-24-23-12(3)25(19)20;7-5-6-1-3-8-4-2-6/h4-7,10-11H,8-9H2,1-3H3;5H,1-4H2/t10-,11+;/m0./s1 |
| InChIKey | WKEUKTBAQYFVMV-VZXYPILPSA-N |
| XLogP | 4.41 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|