C27H26N4S — CID 19780660
3,7-dimethyl-9-[4-(2-phenylethyl)phenyl]-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene (PubChem CID 19780660) has the molecular formula C27H26N4S and a molecular weight of 438.60 g/mol. Its IUPAC name is 3,7-dimethyl-9-[4-(2-phenylethyl)phenyl]-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene.
| Compound Name | 3,7-dimethyl-9-[4-(2-phenylethyl)phenyl]-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene |
|---|---|
| PubChem CID | 19780660 |
| Molecular Formula | C27H26N4S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3,7-dimethyl-9-[4-(2-phenylethyl)phenyl]-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene |
| SMILES | Cc1nnc2n1-c1sc3c(c1C(c1ccc(CCc4ccccc4)cc1)=NC2C)CCC3 |
| InChI | InChI=1S/C27H26N4S/c1-17-26-30-29-18(2)31(26)27-24(22-9-6-10-23(22)32-27)25(28-17)21-15-13-20(14-16-21)12-11-19-7-4-3-5-8-19/h3-5,7-8,13-17H,6,9-12H2,1-2H3 |
| InChIKey | OWFAWZATNGNBEB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |