C18H21ClN4O3 — CID 168948977
tert-butyl 5-[(2-chloro-6-methylpyridine-3-carbonyl)amino]-4-cyclopropylpyrazole-1-carboxylate (PubChem CID 168948977) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is tert-butyl 5-[(2-chloro-6-methylpyridine-3-carbonyl)amino]-4-cyclopropylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-[(2-chloro-6-methylpyridine-3-carbonyl)amino]-4-cyclopropylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 168948977 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | tert-butyl 5-[(2-chloro-6-methylpyridine-3-carbonyl)amino]-4-cyclopropylpyrazole-1-carboxylate |
| SMILES | Cc1ccc(C(=O)Nc2c(C3CC3)cnn2C(=O)OC(C)(C)C)c(Cl)n1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-10-5-8-12(14(19)21-10)16(24)22-15-13(11-6-7-11)9-20-23(15)17(25)26-18(2,3)4/h5,8-9,11H,6-7H2,1-4H3,(H,22,24) |
| InChIKey | DKUVBXDRYLUDHF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|