C17H33NO5 — CID 168950838
N-decyl-N-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetamide (PubChem CID 168950838) has the molecular formula C17H33NO5 and a molecular weight of 331.45 g/mol. Its IUPAC name is N-decyl-N-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetamide.
| Compound Name | N-decyl-N-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 168950838 |
| Molecular Formula | C17H33NO5 |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | N-decyl-N-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetamide |
| SMILES | CCCCCCCCCCN(C(C)=O)C1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H33NO5/c1-3-4-5-6-7-8-9-10-11-18(13(2)19)17-16(22)15(21)14(20)12-23-17/h14-17,20-22H,3-12H2,1-2H3/t14-,15+,16-,17?/m1/s1 |
| InChIKey | APLQCIMQHAFHFL-LVYZTWJOSA-N |
| XLogP | 1.41 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|