C19H35NO9 — CID 177089602
N-[3,4-dihydroxy-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]-N-heptan-2-ylacetamide (PubChem CID 177089602) has the molecular formula C19H35NO9 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[3,4-dihydroxy-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]-N-heptan-2-ylacetamide.
| Compound Name | N-[3,4-dihydroxy-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]-N-heptan-2-ylacetamide |
|---|---|
| PubChem CID | 177089602 |
| Molecular Formula | C19H35NO9 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-[3,4-dihydroxy-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]-N-heptan-2-ylacetamide |
| SMILES | CCCCCC(C)N(C(C)=O)C1OCC(OC2OCC(O)C(O)C2O)C(O)C1O |
| InChI | InChI=1S/C19H35NO9/c1-4-5-6-7-10(2)20(11(3)21)18-16(25)15(24)13(9-27-18)29-19-17(26)14(23)12(22)8-28-19/h10,12-19,22-26H,4-9H2,1-3H3 |
| InChIKey | XOUVCSLHWORUES-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|