C16H9F3N2O3S — CID 168953768
(5Z)-5-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 168953768) has the molecular formula C16H9F3N2O3S and a molecular weight of 366.32 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 168953768 |
| Molecular Formula | C16H9F3N2O3S |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (5Z)-5-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(-c3ccc(OC(F)(F)F)cc3)c2)S1 |
| InChI | InChI=1S/C16H9F3N2O3S/c17-16(18,19)24-11-3-1-10(2-4-11)12-7-9(5-6-20-12)8-13-14(22)21-15(23)25-13/h1-8H,(H,21,22,23)/b13-8- |
| InChIKey | HMCBRVLKKSBZSA-JYRVWZFOSA-N |
| XLogP | 3.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|