C12H8F3NO3S — CID 87403926
5-[[4-(1,1,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87403926) has the molecular formula C12H8F3NO3S and a molecular weight of 303.26 g/mol. Its IUPAC name is 5-[[4-(1,1,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(1,1,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87403926 |
| Molecular Formula | C12H8F3NO3S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 5-[[4-(1,1,2-trifluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OC(F)(F)CF)cc2)S1 |
| InChI | InChI=1S/C12H8F3NO3S/c13-6-12(14,15)19-8-3-1-7(2-4-8)5-9-10(17)16-11(18)20-9/h1-5H,6H2,(H,16,17,18) |
| InChIKey | IWDNDSOCFZPXGM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|