C57H102N2O6S2 — CID 168955470
2-[1-[2-[2-[4-[2-[5,5-bis[(Z)-oct-5-enoxy]pentanoyloxy]ethyl]piperidin-1-yl]ethyldisulfanyl]ethyl]piperidin-4-yl]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 168955470) has the molecular formula C57H102N2O6S2 and a molecular weight of 975.58 g/mol. Its IUPAC name is 2-[1-[2-[2-[4-[2-[5,5-bis[(Z)-oct-5-enoxy]pentanoyloxy]ethyl]piperidin-1-yl]ethyldisulfanyl]ethyl]piperidin-4-yl]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-[1-[2-[2-[4-[2-[5,5-bis[(Z)-oct-5-enoxy]pentanoyloxy]ethyl]piperidin-1-yl]ethyldisulfanyl]ethyl]piperidin-4-yl]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 168955470 |
| Molecular Formula | C57H102N2O6S2 |
| Molecular Weight | 975.58 g/mol |
| Exact Mass | 974.72 |
| IUPAC Name | 2-[1-[2-[2-[4-[2-[5,5-bis[(Z)-oct-5-enoxy]pentanoyloxy]ethyl]piperidin-1-yl]ethyldisulfanyl]ethyl]piperidin-4-yl]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\CCCCOC(CCCC(=O)OCCC1CCN(CCSSCCN2CCC(CCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CC2)CC1)OCCCC/C=C\CC |
| InChI | InChI=1S/C57H102N2O6S2/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-25-28-32-55(60)62-49-39-53-35-41-58(42-36-53)45-51-66-67-52-46-59-43-37-54(38-44-59)40-50-63-56(61)33-31-34-57(64-47-29-26-14-11-8-5-2)65-48-30-27-15-12-9-6-3/h8-9,11-12,16-17,19-20,53-54,57H,4-7,10,13-15,18,21-52H2,1-3H3/b11-8-,12-9-,17-16-,20-19- |
| InChIKey | UYEMSIPMNKPUPX-QBXBLZHRSA-N |
| XLogP | 15.27 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.58 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|