C56H92N2O12 — CID 168955681
7-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-2-[[7-[(Z)-non-3-enoxy]-7-oxoheptanoyl]oxymethyl]-3-(2-pyrrolidin-1-ylethylcarbamoyloxy)propyl] 1-O-[(Z)-non-3-enyl] heptanedioate (PubChem CID 168955681) has the molecular formula C56H92N2O12 and a molecular weight of 985.35 g/mol. Its IUPAC name is 7-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-2-[[7-[(Z)-non-3-enoxy]-7-oxoheptanoyl]oxymethyl]-3-(2-pyrrolidin-1-ylethylcarbamoyloxy)propyl] 1-O-[(Z)-non-3-enyl] heptanedioate.
| Compound Name | 7-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-2-[[7-[(Z)-non-3-enoxy]-7-oxoheptanoyl]oxymethyl]-3-(2-pyrrolidin-1-ylethylcarbamoyloxy)propyl] 1-O-[(Z)-non-3-enyl] heptanedioate |
|---|---|
| PubChem CID | 168955681 |
| Molecular Formula | C56H92N2O12 |
| Molecular Weight | 985.35 g/mol |
| Exact Mass | 984.67 |
| IUPAC Name | 7-O-[2-[[2-(1-adamantyl)acetyl]oxymethyl]-2-[[7-[(Z)-non-3-enoxy]-7-oxoheptanoyl]oxymethyl]-3-(2-pyrrolidin-1-ylethylcarbamoyloxy)propyl] 1-O-[(Z)-non-3-enyl] heptanedioate |
| SMILES | CCCCC/C=C\CCOC(=O)CCCCCC(=O)OCC(COC(=O)CCCCCC(=O)OCC/C=C\CCCCC)(COC(=O)CC12CC3CC(CC(C3)C1)C2)COC(=O)NCCN1CCCC1 |
| InChI | InChI=1S/C56H92N2O12/c1-3-5-7-9-11-13-23-33-65-49(59)25-17-15-19-27-51(61)67-42-56(45-70-54(64)57-29-32-58-30-21-22-31-58,44-69-53(63)41-55-38-46-35-47(39-55)37-48(36-46)40-55)43-68-52(62)28-20-16-18-26-50(60)66-34-24-14-12-10-8-6-4-2/h11-14,46-48H,3-10,15-45H2,1-2H3,(H,57,64)/b13-11-,14-12- |
| InChIKey | SENSSYQXFUKCJL-XSYHWHKQSA-N |
| XLogP | 11.07 |
| TPSA | 173.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.35 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|