C11H9FN2O3 — CID 168957479
3-ethyl-8-fluoro-2,4-dioxo-1H-quinazoline-7-carbaldehyde (PubChem CID 168957479) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 3-ethyl-8-fluoro-2,4-dioxo-1H-quinazoline-7-carbaldehyde.
| Compound Name | 3-ethyl-8-fluoro-2,4-dioxo-1H-quinazoline-7-carbaldehyde |
|---|---|
| PubChem CID | 168957479 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-ethyl-8-fluoro-2,4-dioxo-1H-quinazoline-7-carbaldehyde |
| SMILES | CCn1c(=O)[nH]c2c(F)c(C=O)ccc2c1=O |
| InChI | InChI=1S/C11H9FN2O3/c1-2-14-10(16)7-4-3-6(5-15)8(12)9(7)13-11(14)17/h3-5H,2H2,1H3,(H,13,17) |
| InChIKey | CMELJXRJUIZKMC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|