C11H21FN2O2 — CID 168957805
N-ethyl-3-(1-fluoropyrrolidin-2-yl)-3-methoxy-2-methylpropanamide (PubChem CID 168957805) has the molecular formula C11H21FN2O2 and a molecular weight of 232.30 g/mol. Its IUPAC name is N-ethyl-3-(1-fluoropyrrolidin-2-yl)-3-methoxy-2-methylpropanamide.
| Compound Name | N-ethyl-3-(1-fluoropyrrolidin-2-yl)-3-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 168957805 |
| Molecular Formula | C11H21FN2O2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-ethyl-3-(1-fluoropyrrolidin-2-yl)-3-methoxy-2-methylpropanamide |
| SMILES | CCNC(=O)C(C)C(OC)C1CCCN1F |
| InChI | InChI=1S/C11H21FN2O2/c1-4-13-11(15)8(2)10(16-3)9-6-5-7-14(9)12/h8-10H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | HYQVNPYWFLAPQP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|