C12H25N3O2 — CID 59064270
(2R,3R)-N-[(dimethylamino)methyl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide (PubChem CID 59064270) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2R,3R)-N-[(dimethylamino)methyl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide.
| Compound Name | (2R,3R)-N-[(dimethylamino)methyl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide |
|---|---|
| PubChem CID | 59064270 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | (2R,3R)-N-[(dimethylamino)methyl]-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanamide |
| SMILES | CO[C@@H]([C@@H]1CCCN1)[C@@H](C)C(=O)NCN(C)C |
| InChI | InChI=1S/C12H25N3O2/c1-9(12(16)14-8-15(2)3)11(17-4)10-6-5-7-13-10/h9-11,13H,5-8H2,1-4H3,(H,14,16)/t9-,10+,11-/m1/s1 |
| InChIKey | VZTQYDAJGAQSEY-OUAUKWLOSA-N |
| XLogP | 0.02 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|