C10H21N2O2+ — CID 59974252
3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-1-ium-2-yl]propanamide (PubChem CID 59974252) has the molecular formula C10H21N2O2+ and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-1-ium-2-yl]propanamide.
| Compound Name | 3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-1-ium-2-yl]propanamide |
|---|---|
| PubChem CID | 59974252 |
| Molecular Formula | C10H21N2O2+ |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 3-methoxy-N,2-dimethyl-3-[(2S)-pyrrolidin-1-ium-2-yl]propanamide |
| SMILES | CNC(=O)C(C)C(OC)[C@@H]1CCC[NH2+]1 |
| InChI | InChI=1S/C10H20N2O2/c1-7(10(13)11-2)9(14-3)8-5-4-6-12-8/h7-9,12H,4-6H2,1-3H3,(H,11,13)/p+1/t7?,8-,9?/m0/s1 |
| InChIKey | LGKOIUOHLWHLMK-MGURRDGZSA-O |
| XLogP | -0.89 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |