C12H24N3O2+ — CID 59064269
[[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]methyl-methyl-methylideneazanium (PubChem CID 59064269) has the molecular formula C12H24N3O2+ and a molecular weight of 242.34 g/mol. Its IUPAC name is [[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]methyl-methyl-methylideneazanium.
| Compound Name | [[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]methyl-methyl-methylideneazanium |
|---|---|
| PubChem CID | 59064269 |
| Molecular Formula | C12H24N3O2+ |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | [[(2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoyl]amino]methyl-methyl-methylideneazanium |
| SMILES | C=[N+](C)CNC(=O)[C@H](C)[C@@H](OC)[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H23N3O2/c1-9(12(16)14-8-15(2)3)11(17-4)10-6-5-7-13-10/h9-11,13H,2,5-8H2,1,3-4H3/p+1/t9-,10+,11-/m1/s1 |
| InChIKey | XQWNRCNUKLIMJX-OUAUKWLOSA-O |
| XLogP | -0.19 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|