C29H32N2O3S — CID 168959953
tert-butyl N-[[9-ethyl-7-[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]carbazol-3-yl]methyl]-N-methylcarbamate (PubChem CID 168959953) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is tert-butyl N-[[9-ethyl-7-[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]carbazol-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[9-ethyl-7-[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]carbazol-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168959953 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | tert-butyl N-[[9-ethyl-7-[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]carbazol-3-yl]methyl]-N-methylcarbamate |
| SMILES | CCn1c2ccc(CN(C)C(=O)OC(C)(C)C)cc2c2ccc(-c3cc(C#CCCO)cs3)cc21 |
| InChI | InChI=1S/C29H32N2O3S/c1-6-31-25-13-10-20(18-30(5)28(33)34-29(2,3)4)15-24(25)23-12-11-22(17-26(23)31)27-16-21(19-35-27)9-7-8-14-32/h10-13,15-17,19,32H,6,8,14,18H2,1-5H3 |
| InChIKey | ACTUFRNPMCTNDB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|