C8H4F3NOS — CID 168966904
7-(trifluoromethyl)-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 168966904) has the molecular formula C8H4F3NOS and a molecular weight of 219.19 g/mol. Its IUPAC name is 7-(trifluoromethyl)-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | 7-(trifluoromethyl)-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 168966904 |
| Molecular Formula | C8H4F3NOS |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 7-(trifluoromethyl)-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | O=c1cc(C(F)(F)F)c2sccc2[nH]1 |
| InChI | InChI=1S/C8H4F3NOS/c9-8(10,11)4-3-6(13)12-5-1-2-14-7(4)5/h1-3H,(H,12,13) |
| InChIKey | REHXAONAMKWXFC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |