C6H4N2OS2 — CID 119093676
4-sulfanylidene-1H-thieno[3,2-d]pyrimidin-2-one (PubChem CID 119093676) has the molecular formula C6H4N2OS2 and a molecular weight of 184.25 g/mol. Its IUPAC name is 4-sulfanylidene-1H-thieno[3,2-d]pyrimidin-2-one.
| Compound Name | 4-sulfanylidene-1H-thieno[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 119093676 |
| Molecular Formula | C6H4N2OS2 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 4-sulfanylidene-1H-thieno[3,2-d]pyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)c2sccc2[nH]1 |
| InChI | InChI=1S/C6H4N2OS2/c9-6-7-3-1-2-11-4(3)5(10)8-6/h1-2H,(H2,7,8,9,10) |
| InChIKey | BGPXYHIEXPESLU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|