C9H5N3O3S — CID 14906136
6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4-triene-8,10,13-trione (PubChem CID 14906136) has the molecular formula C9H5N3O3S and a molecular weight of 235.22 g/mol. Its IUPAC name is 6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4-triene-8,10,13-trione.
| Compound Name | 6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4-triene-8,10,13-trione |
|---|---|
| PubChem CID | 14906136 |
| Molecular Formula | C9H5N3O3S |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4-triene-8,10,13-trione |
| SMILES | O=c1[nH][nH]c(=O)c2c(=O)c3sccc3[nH]c12 |
| InChI | InChI=1S/C9H5N3O3S/c13-6-4-5(9(15)12-11-8(4)14)10-3-1-2-16-7(3)6/h1-2H,(H,10,13)(H,11,14)(H,12,15) |
| InChIKey | RGYZJVTVTALEJJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |