C12H6Cl5N4O3PS2 — CID 162242288
2,4-dichlorothieno[3,2-d]pyrimidine;phosphoryl trichloride;1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 162242288) has the molecular formula C12H6Cl5N4O3PS2 and a molecular weight of 526.58 g/mol. Its IUPAC name is 2,4-dichlorothieno[3,2-d]pyrimidine;phosphoryl trichloride;1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 2,4-dichlorothieno[3,2-d]pyrimidine;phosphoryl trichloride;1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162242288 |
| Molecular Formula | C12H6Cl5N4O3PS2 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 523.81 |
| IUPAC Name | 2,4-dichlorothieno[3,2-d]pyrimidine;phosphoryl trichloride;1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | Clc1nc(Cl)c2sccc2n1.O=P(Cl)(Cl)Cl.O=c1[nH]c(=O)c2sccc2[nH]1 |
| InChI | InChI=1S/C6H2Cl2N2S.C6H4N2O2S.Cl3OP/c7-5-4-3(1-2-11-4)9-6(8)10-5;9-5-4-3(1-2-11-4)7-6(10)8-5;1-5(2,3)4/h1-2H;1-2H,(H2,7,8,9,10); |
| InChIKey | ZWWABBOZTHSURN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|