C18H23NO4 — CID 168968344
phenyl 6-[(2-methylcycloprop-2-en-1-yl)methoxycarbonylamino]hexanoate (PubChem CID 168968344) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is phenyl 6-[(2-methylcycloprop-2-en-1-yl)methoxycarbonylamino]hexanoate.
| Compound Name | phenyl 6-[(2-methylcycloprop-2-en-1-yl)methoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 168968344 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | phenyl 6-[(2-methylcycloprop-2-en-1-yl)methoxycarbonylamino]hexanoate |
| SMILES | CC1=CC1COC(=O)NCCCCCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c1-14-12-15(14)13-22-18(21)19-11-7-3-6-10-17(20)23-16-8-4-2-5-9-16/h2,4-5,8-9,12,15H,3,6-7,10-11,13H2,1H3,(H,19,21) |
| InChIKey | WKAFPJVCLDKKFW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|